About 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole
2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole (PubChem CID 67402806) has the molecular formula C35H29N3
and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole.
Molecular Properties
| Compound Name | 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole |
| PubChem CID | 67402806 |
| Molecular Formula | C35H29N3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole |
| SMILES | C1=CN=C(c2ccccc2)C1.c1ccc(-c2ccccn2)cc1.c1ccc(C2=Nc3ccccc3C2)cc1 |
| InChI | InChI=1S/C14H11N.C11H9N.C10H9N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2-5-9(6-3-1)10-7-4-8-11-10/h1-9H,10H2;1-9H;1-6,8H,7H2 |
| InChIKey | JHZOAOSARAMSTL-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole?
The IUPAC name of 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole (CID 67402806) is 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole.
What is the SMILES notation for 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole?
The canonical SMILES for 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole is C1=CN=C(c2ccccc2)C1.c1ccc(-c2ccccn2)cc1.c1ccc(C2=Nc3ccccc3C2)cc1.
What is the InChIKey of 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole?
The InChIKey is JHZOAOSARAMSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C11H9N.C10H9N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2-5-9(6-3-1)10-7-4-8-11-10/h1-9H,10H2;1-9H;1-6,8H,7H2.
What are the key properties of 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole?
2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole has a molecular weight of 491.64 g/mol, XLogP of 8.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3H-indole;2-phenylpyridine;2-phenyl-3H-pyrrole is sourced from PubChem (CID 67402806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).