About 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne
2-phenylpyridine;3-prop-2-ynoxyprop-1-yne (PubChem CID 157135831) has the molecular formula C17H15NO
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne.
Molecular Properties
| Compound Name | 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne |
| PubChem CID | 157135831 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne |
| SMILES | C#CCOCC#C.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C11H9N.C6H6O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-3-5-7-6-4-2/h1-9H;1-2H,5-6H2 |
| InChIKey | AJPMCQPLXBPRQO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne?
The IUPAC name of 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne (CID 157135831) is 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne.
What is the SMILES notation for 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne?
The canonical SMILES for 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne is C#CCOCC#C.c1ccc(-c2ccccn2)cc1.
What is the InChIKey of 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne?
The InChIKey is AJPMCQPLXBPRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N.C6H6O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-3-5-7-6-4-2/h1-9H;1-2H,5-6H2.
What are the key properties of 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne?
2-phenylpyridine;3-prop-2-ynoxyprop-1-yne has a molecular weight of 249.31 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyridine;3-prop-2-ynoxyprop-1-yne is sourced from PubChem (CID 157135831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).