C15H14N4O4 — CID 102396174
8,10-dimethyl-4-phenyl-1,3,8,10-tetrazaspiro[5.5]undec-3-ene-2,7,9,11-tetrone (PubChem CID 102396174) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 8,10-dimethyl-4-phenyl-1,3,8,10-tetrazaspiro[5.5]undec-3-ene-2,7,9,11-tetrone.
| Compound Name | 8,10-dimethyl-4-phenyl-1,3,8,10-tetrazaspiro[5.5]undec-3-ene-2,7,9,11-tetrone |
|---|---|
| PubChem CID | 102396174 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 8,10-dimethyl-4-phenyl-1,3,8,10-tetrazaspiro[5.5]undec-3-ene-2,7,9,11-tetrone |
| SMILES | CN1C(=O)N(C)C(=O)C2(CC(c3ccccc3)=NC(=O)N2)C1=O |
| InChI | InChI=1S/C15H14N4O4/c1-18-11(20)15(12(21)19(2)14(18)23)8-10(16-13(22)17-15)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,17,22) |
| InChIKey | OKCXGJPMDSXXSE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|