C30H25N3O5 — CID 139086730
5'-([1,1'-Biphenyl]-4-yl)-1',1'',3''-trimethyldispiro[indane-2,2'-pyrrolidine-4',5''-[1,3]diazinane]-1,3,2'',4'',6''-pentaone (PubChem CID 139086730) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol.
| Compound Name | 5'-([1,1'-Biphenyl]-4-yl)-1',1'',3''-trimethyldispiro[indane-2,2'-pyrrolidine-4',5''-[1,3]diazinane]-1,3,2'',4'',6''-pentaone |
|---|---|
| PubChem CID | 139086730 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | — |
| SMILES | CN1C(=O)N(C)C(=O)C2(CC3(C(=O)c4ccccc4C3=O)N(C)[C@H]2c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C30H25N3O5/c1-31-26(36)29(27(37)32(2)28(31)38)17-30(24(34)21-11-7-8-12-22(21)25(30)35)33(3)23(29)20-15-13-19(14-16-20)18-9-5-4-6-10-18/h4-16,23H,17H2,1-3H3/t23-/m0/s1 |
| InChIKey | VVXNSIIMSFBFSZ-QHCPKHFHSA-N |
| XLogP | 3.59 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|