C17H17N3O6S — CID 138983450
(3'R,10'bS)-3'-ethenyl-1,3-dimethyl-5',5'-dioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[1,2-c][1,2,3]benzoxathiazine]-2,4,6-trione (PubChem CID 138983450) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is (3'R,10'bS)-3'-ethenyl-1,3-dimethyl-5',5'-dioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[1,2-c][1,2,3]benzoxathiazine]-2,4,6-trione.
| Compound Name | (3'R,10'bS)-3'-ethenyl-1,3-dimethyl-5',5'-dioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[1,2-c][1,2,3]benzoxathiazine]-2,4,6-trione |
|---|---|
| PubChem CID | 138983450 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (3'R,10'bS)-3'-ethenyl-1,3-dimethyl-5',5'-dioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[1,2-c][1,2,3]benzoxathiazine]-2,4,6-trione |
| SMILES | C=C[C@H]1CC2(C(=O)N(C)C(=O)N(C)C2=O)[C@@H]2c3ccccc3OS(=O)(=O)N21 |
| InChI | InChI=1S/C17H17N3O6S/c1-4-10-9-17(14(21)18(2)16(23)19(3)15(17)22)13-11-7-5-6-8-12(11)26-27(24,25)20(10)13/h4-8,10,13H,1,9H2,2-3H3/t10-,13-/m0/s1 |
| InChIKey | COSIYIALYJZSMR-GWCFXTLKSA-N |
| XLogP | 0.66 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|