C16H17NO — CID 10847599
(1R,9R)-14-methyl-14-azatetracyclo[7.6.1.01,12.03,8]hexadeca-3,5,7,11-tetraen-15-one (PubChem CID 10847599) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (1R,9R)-14-methyl-14-azatetracyclo[7.6.1.01,12.03,8]hexadeca-3,5,7,11-tetraen-15-one.
| Compound Name | (1R,9R)-14-methyl-14-azatetracyclo[7.6.1.01,12.03,8]hexadeca-3,5,7,11-tetraen-15-one |
|---|---|
| PubChem CID | 10847599 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1R,9R)-14-methyl-14-azatetracyclo[7.6.1.01,12.03,8]hexadeca-3,5,7,11-tetraen-15-one |
| SMILES | CN1CC2=CC[C@@H]3C[C@]2(Cc2ccccc23)C1=O |
| InChI | InChI=1S/C16H17NO/c1-17-10-13-7-6-12-9-16(13,15(17)18)8-11-4-2-3-5-14(11)12/h2-5,7,12H,6,8-10H2,1H3/t12-,16+/m1/s1 |
| InChIKey | MWWPBKOOOWGYSV-WBMJQRKESA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|