C13H17NO — CID 11481120
2,5,5-trimethyl-1,4-dihydro-2-benzazepin-3-one (PubChem CID 11481120) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2,5,5-trimethyl-1,4-dihydro-2-benzazepin-3-one.
| Compound Name | 2,5,5-trimethyl-1,4-dihydro-2-benzazepin-3-one |
|---|---|
| PubChem CID | 11481120 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2,5,5-trimethyl-1,4-dihydro-2-benzazepin-3-one |
| SMILES | CN1Cc2ccccc2C(C)(C)CC1=O |
| InChI | InChI=1S/C13H17NO/c1-13(2)8-12(15)14(3)9-10-6-4-5-7-11(10)13/h4-7H,8-9H2,1-3H3 |
| InChIKey | NTCHQVVSFDGKDQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |