C12H14INO2 — CID 143581392
iodo 4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate (PubChem CID 143581392) has the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. Its IUPAC name is iodo 4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate.
| Compound Name | iodo 4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 143581392 |
| Molecular Formula | C12H14INO2 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | iodo 4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
| SMILES | CC1(C)CN(C(=O)OI)Cc2ccccc21 |
| InChI | InChI=1S/C12H14INO2/c1-12(2)8-14(11(15)16-13)7-9-5-3-4-6-10(9)12/h3-6H,7-8H2,1-2H3 |
| InChIKey | PEXAICZZFLUNKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|