C16H14N2O3S — CID 146162058
(8S,13aS)-8-ethenyl-13,13a-dihydro-8H-quinazolino[3,2-c][1,2,3]benzoxathiazine 6,6-dioxide (PubChem CID 146162058) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is (8S,13aS)-8-ethenyl-13,13a-dihydro-8H-quinazolino[3,2-c][1,2,3]benzoxathiazine 6,6-dioxide.
| Compound Name | (8S,13aS)-8-ethenyl-13,13a-dihydro-8H-quinazolino[3,2-c][1,2,3]benzoxathiazine 6,6-dioxide |
|---|---|
| PubChem CID | 146162058 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (8S,13aS)-8-ethenyl-13,13a-dihydro-8H-quinazolino[3,2-c][1,2,3]benzoxathiazine 6,6-dioxide |
| SMILES | C=C[C@H]1c2ccccc2N[C@@H]2c3ccccc3OS(=O)(=O)N21 |
| InChI | InChI=1S/C16H14N2O3S/c1-2-14-11-7-3-5-9-13(11)17-16-12-8-4-6-10-15(12)21-22(19,20)18(14)16/h2-10,14,16-17H,1H2/t14-,16-/m0/s1 |
| InChIKey | CAROECMTWKPITO-HOCLYGCPSA-N |
| XLogP | 2.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|