C9H10O3S — CID 134963054
(4S)-4-methyl-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 134963054) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is (4S)-4-methyl-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide.
| Compound Name | (4S)-4-methyl-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 134963054 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (4S)-4-methyl-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | C[C@@H]1CS(=O)(=O)Oc2ccccc21 |
| InChI | InChI=1S/C9H10O3S/c1-7-6-13(10,11)12-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3/t7-/m1/s1 |
| InChIKey | CAAMIXQJXPDGKN-SSDOTTSWSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|