C16H16N2O7S2 — CID 172985192
2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-amine;(NZ)-N-(2,2-dioxo-1,2λ6-benzoxathiin-4-ylidene)hydroxylamine (PubChem CID 172985192) has the molecular formula C16H16N2O7S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-amine;(NZ)-N-(2,2-dioxo-1,2λ6-benzoxathiin-4-ylidene)hydroxylamine.
| Compound Name | 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-amine;(NZ)-N-(2,2-dioxo-1,2λ6-benzoxathiin-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 172985192 |
| Molecular Formula | C16H16N2O7S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-amine;(NZ)-N-(2,2-dioxo-1,2λ6-benzoxathiin-4-ylidene)hydroxylamine |
| SMILES | NC1CS(=O)(=O)Oc2ccccc21.O=S1(=O)C/C(=N\O)c2ccccc2O1 |
| InChI | InChI=1S/C8H7NO4S.C8H9NO3S/c10-9-7-5-14(11,12)13-8-4-2-1-3-6(7)8;9-7-5-13(10,11)12-8-4-2-1-3-6(7)8/h1-4,10H,5H2;1-4,7H,5,9H2/b9-7+; |
| InChIKey | XNPVBARSYOGYRZ-BXTVWIJMSA-N |
| XLogP | 1.00 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|