C12H15NO2 — CID 166853400
(NZ)-N-(2-propan-2-yl-2,3-dihydrochromen-4-ylidene)hydroxylamine (PubChem CID 166853400) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (NZ)-N-(2-propan-2-yl-2,3-dihydrochromen-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2-propan-2-yl-2,3-dihydrochromen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 166853400 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (NZ)-N-(2-propan-2-yl-2,3-dihydrochromen-4-ylidene)hydroxylamine |
| SMILES | CC(C)C1C/C(=N/O)c2ccccc2O1 |
| InChI | InChI=1S/C12H15NO2/c1-8(2)12-7-10(13-14)9-5-3-4-6-11(9)15-12/h3-6,8,12,14H,7H2,1-2H3/b13-10- |
| InChIKey | DSAOMWORYCKFAK-RAXLEYEMSA-N |
| XLogP | 2.67 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|