C9H10O2 — CID 54240008
4-methyl-3,4-dihydro-1,2-benzodioxine (PubChem CID 54240008) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-methyl-3,4-dihydro-1,2-benzodioxine.
| Compound Name | 4-methyl-3,4-dihydro-1,2-benzodioxine |
|---|---|
| PubChem CID | 54240008 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-methyl-3,4-dihydro-1,2-benzodioxine |
| SMILES | CC1COOc2ccccc21 |
| InChI | InChI=1S/C9H10O2/c1-7-6-10-11-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3 |
| InChIKey | QPIPUSFFBGQTMA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|