C18H20O3 — CID 173144157
4-(2-butoxyphenyl)-3,4-dihydro-1,2-benzodioxine (PubChem CID 173144157) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(2-butoxyphenyl)-3,4-dihydro-1,2-benzodioxine.
| Compound Name | 4-(2-butoxyphenyl)-3,4-dihydro-1,2-benzodioxine |
|---|---|
| PubChem CID | 173144157 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(2-butoxyphenyl)-3,4-dihydro-1,2-benzodioxine |
| SMILES | CCCCOc1ccccc1C1COOc2ccccc21 |
| InChI | InChI=1S/C18H20O3/c1-2-3-12-19-17-10-6-4-8-14(17)16-13-20-21-18-11-7-5-9-15(16)18/h4-11,16H,2-3,12-13H2,1H3 |
| InChIKey | AVLMNDGFSKSKFE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|