About 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine
5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine (PubChem CID 90793601) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine.
Molecular Properties
| Compound Name | 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine |
| PubChem CID | 90793601 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine |
| SMILES | CCCCOc1cccc2c1C(c1ccccc1)COO2 |
| InChI | InChI=1S/C18H20O3/c1-2-3-12-19-16-10-7-11-17-18(16)15(13-20-21-17)14-8-5-4-6-9-14/h4-11,15H,2-3,12-13H2,1H3 |
| InChIKey | JRBSARUIJVRUGY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine?
The IUPAC name of 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine (CID 90793601) is 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine.
What is the SMILES notation for 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine?
The canonical SMILES for 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine is CCCCOc1cccc2c1C(c1ccccc1)COO2.
What is the InChIKey of 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine?
The InChIKey is JRBSARUIJVRUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-2-3-12-19-16-10-7-11-17-18(16)15(13-20-21-17)14-8-5-4-6-9-14/h4-11,15H,2-3,12-13H2,1H3.
What are the key properties of 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine?
5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine has a molecular weight of 284.36 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-4-phenyl-3,4-dihydro-1,2-benzodioxine is sourced from PubChem (CID 90793601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).