C19H31NO2 — CID 82462052
5-butoxy-N-butyl-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 82462052) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 5-butoxy-N-butyl-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 5-butoxy-N-butyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 82462052 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 5-butoxy-N-butyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCNC1CC(C)(C)Oc2cccc(OCCCC)c21 |
| InChI | InChI=1S/C19H31NO2/c1-5-7-12-20-15-14-19(3,4)22-17-11-9-10-16(18(15)17)21-13-8-6-2/h9-11,15,20H,5-8,12-14H2,1-4H3 |
| InChIKey | USIJDELQONZHKA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|