C18H25NO2 — CID 62311714
7-but-2-ynoxy-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine (PubChem CID 62311714) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 7-but-2-ynoxy-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7-but-2-ynoxy-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 62311714 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 7-but-2-ynoxy-2,2-dimethyl-N-propyl-3,4-dihydrochromen-4-amine |
| SMILES | CC#CCOc1ccc2c(c1)OC(C)(C)CC2NCCC |
| InChI | InChI=1S/C18H25NO2/c1-5-7-11-20-14-8-9-15-16(19-10-6-2)13-18(3,4)21-17(15)12-14/h8-9,12,16,19H,6,10-11,13H2,1-4H3 |
| InChIKey | MVKGPVIUCXRGIK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|