C19H22F2N2O4S — CID 89373314
(2R,3S)-4-(3,5-difluorophenyl)-1-[(2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-(methylamino)butan-2-ol (PubChem CID 89373314) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is (2R,3S)-4-(3,5-difluorophenyl)-1-[(2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-(methylamino)butan-2-ol.
| Compound Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[(2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-(methylamino)butan-2-ol |
|---|---|
| PubChem CID | 89373314 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[(2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-(methylamino)butan-2-ol |
| SMILES | CN[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNC1CS(=O)(=O)Oc2ccccc21 |
| InChI | InChI=1S/C19H22F2N2O4S/c1-22-16(8-12-6-13(20)9-14(21)7-12)18(24)10-23-17-11-28(25,26)27-19-5-3-2-4-15(17)19/h2-7,9,16-18,22-24H,8,10-11H2,1H3/t16-,17?,18+/m0/s1 |
| InChIKey | NRUZNFZUWHYRJY-PXKIYYGHSA-N |
| XLogP | 1.51 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|