C31H36F2N2O4S — CID 69299378
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]benzamide (PubChem CID 69299378) has the molecular formula C31H36F2N2O4S and a molecular weight of 570.70 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]benzamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]benzamide |
|---|---|
| PubChem CID | 69299378 |
| Molecular Formula | C31H36F2N2O4S |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]benzamide |
| SMILES | CC(C)(C)Cc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1ccccc1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C31H36F2N2O4S/c1-31(2,3)16-20-9-10-23-18-40(38,39)19-28(26(23)13-20)34-17-29(36)27(14-21-11-24(32)15-25(33)12-21)35-30(37)22-7-5-4-6-8-22/h4-13,15,27-29,34,36H,14,16-19H2,1-3H3,(H,35,37)/t27-,28-,29+/m0/s1 |
| InChIKey | HYGVTJWUDTVSGF-YTCPBCGMSA-N |
| XLogP | 4.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |