C29H38F2N2O3 — CID 68696804
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-(2,2-dimethylpropyl)-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 68696804) has the molecular formula C29H38F2N2O3 and a molecular weight of 500.63 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-(2,2-dimethylpropyl)-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-(2,2-dimethylpropyl)-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68696804 |
| Molecular Formula | C29H38F2N2O3 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-(2,2-dimethylpropyl)-3,3-dimethyl-4-oxo-1,2-dihydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)CN[C@@H]1CC(C)(C)C(=O)c2ccc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C29H38F2N2O3/c1-17(34)33-24(12-19-9-20(30)13-21(31)10-19)26(35)16-32-25-15-29(5,6)27(36)22-8-7-18(11-23(22)25)14-28(2,3)4/h7-11,13,24-26,32,35H,12,14-16H2,1-6H3,(H,33,34)/t24-,25+,26-/m0/s1 |
| InChIKey | RZVBZFXUKAEOIB-NXCFDTQHSA-N |
| XLogP | 4.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |