C28H37F2N3O4 — CID 68697440
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(2R,4R)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,3'-oxolane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 68697440) has the molecular formula C28H37F2N3O4 and a molecular weight of 517.62 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(2R,4R)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,3'-oxolane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(2R,4R)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,3'-oxolane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68697440 |
| Molecular Formula | C28H37F2N3O4 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(2R,4R)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,3'-oxolane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@@H]1C[C@]2(CCOC2)Oc2ncc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C28H37F2N3O4/c1-17(34)33-23(10-18-7-20(29)11-21(30)8-18)25(35)15-31-24-13-28(5-6-36-16-28)37-26-22(24)9-19(14-32-26)12-27(2,3)4/h7-9,11,14,23-25,31,35H,5-6,10,12-13,15-16H2,1-4H3,(H,33,34)/t23-,24+,25+,28-/m0/s1 |
| InChIKey | DMSRCGAVUVUKMW-FQJHJXCSSA-N |
| XLogP | 3.63 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |