C28H36F3N3O3 — CID 68693299
N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(2,3,4-trifluorophenyl)butan-2-yl]acetamide (PubChem CID 68693299) has the molecular formula C28H36F3N3O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(2,3,4-trifluorophenyl)butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(2,3,4-trifluorophenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68693299 |
| Molecular Formula | C28H36F3N3O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(2,3,4-trifluorophenyl)butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1ccc(F)c(F)c1F)[C@H](O)CN[C@H]1CC2(CCC2)Oc2ncc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C28H36F3N3O3/c1-16(35)34-21(11-18-6-7-20(29)25(31)24(18)30)23(36)15-32-22-13-28(8-5-9-28)37-26-19(22)10-17(14-33-26)12-27(2,3)4/h6-7,10,14,21-23,32,36H,5,8-9,11-13,15H2,1-4H3,(H,34,35)/t21-,22-,23+/m0/s1 |
| InChIKey | BUEWYNGUIYACJE-RJGXRXQPSA-N |
| XLogP | 4.53 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|