C26H33F3N2O3 — CID 69471488
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-3-hydroxybutan-2-yl]-2-fluoroacetamide (PubChem CID 69471488) has the molecular formula C26H33F3N2O3 and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-3-hydroxybutan-2-yl]-2-fluoroacetamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-3-hydroxybutan-2-yl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 69471488 |
| Molecular Formula | C26H33F3N2O3 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-3-hydroxybutan-2-yl]-2-fluoroacetamide |
| SMILES | CC(C)(C)Cc1ccc2c(c1)[C@H](NC[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)CF)CCO2 |
| InChI | InChI=1S/C26H33F3N2O3/c1-26(2,3)13-16-4-5-24-20(10-16)21(6-7-34-24)30-15-23(32)22(31-25(33)14-27)11-17-8-18(28)12-19(29)9-17/h4-5,8-10,12,21-23,30,32H,6-7,11,13-15H2,1-3H3,(H,31,33)/t21-,22+,23+/m1/s1 |
| InChIKey | WTTXUEPBGFULOK-VJBWXMMDSA-N |
| XLogP | 4.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |