C26H32F4N2O3 — CID 71814504
N-[(2S,3R)-4-[[(4S)-6-(3,3-difluoro-2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 71814504) has the molecular formula C26H32F4N2O3 and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[(2S,3R)-4-[[(4S)-6-(3,3-difluoro-2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-4-[[(4S)-6-(3,3-difluoro-2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 71814504 |
| Molecular Formula | C26H32F4N2O3 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[(2S,3R)-4-[[(4S)-6-(3,3-difluoro-2,2-dimethylpropyl)-3,4-dihydro-2H-chromen-4-yl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CCOc2ccc(CC(C)(C)C(F)F)cc21 |
| InChI | InChI=1S/C26H32F4N2O3/c1-15(33)32-22(11-17-8-18(27)12-19(28)9-17)23(34)14-31-21-6-7-35-24-5-4-16(10-20(21)24)13-26(2,3)25(29)30/h4-5,8-10,12,21-23,25,31,34H,6-7,11,13-14H2,1-3H3,(H,32,33)/t21-,22-,23+/m0/s1 |
| InChIKey | QCQHEXKLWARFGW-RJGXRXQPSA-N |
| XLogP | 4.32 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |