C23H28F2N2O2S — CID 87644224
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-3,4-dihydro-2H-chromen-4-yl)amino]-3-sulfanylbutan-2-yl]acetamide (PubChem CID 87644224) has the molecular formula C23H28F2N2O2S and a molecular weight of 434.55 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-3,4-dihydro-2H-chromen-4-yl)amino]-3-sulfanylbutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-3,4-dihydro-2H-chromen-4-yl)amino]-3-sulfanylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 87644224 |
| Molecular Formula | C23H28F2N2O2S |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-3,4-dihydro-2H-chromen-4-yl)amino]-3-sulfanylbutan-2-yl]acetamide |
| SMILES | CCc1ccc2c(c1)C(NC[C@@H](S)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O)CCO2 |
| InChI | InChI=1S/C23H28F2N2O2S/c1-3-15-4-5-22-19(10-15)20(6-7-29-22)26-13-23(30)21(27-14(2)28)11-16-8-17(24)12-18(25)9-16/h4-5,8-10,12,20-21,23,26,30H,3,6-7,11,13H2,1-2H3,(H,27,28)/t20?,21-,23+/m0/s1 |
| InChIKey | ZFMSSJWSXHJMCR-CBWCPMJDSA-N |
| XLogP | 3.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|