C29H40FN3O2 — CID 67306501
N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydro-1H-quinoline-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 67306501) has the molecular formula C29H40FN3O2 and a molecular weight of 481.66 g/mol. Its IUPAC name is N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydro-1H-quinoline-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydro-1H-quinoline-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 67306501 |
| Molecular Formula | C29H40FN3O2 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydro-1H-quinoline-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cccc(F)c1)[C@H](O)CN[C@H]1CC2(CCC2)Nc2ccc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C29H40FN3O2/c1-19(34)32-25(15-20-7-5-8-22(30)13-20)27(35)18-31-26-17-29(11-6-12-29)33-24-10-9-21(14-23(24)26)16-28(2,3)4/h5,7-10,13-14,25-27,31,33,35H,6,11-12,15-18H2,1-4H3,(H,32,34)/t25-,26-,27+/m0/s1 |
| InChIKey | BQQKRWHXTZZDJN-GMQQYTKMSA-N |
| XLogP | 4.89 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |