C26H31F3N2O3 — CID 67304855
N-[(2S,3S)-3-hydroxy-1-phenyl-4-[[(4S)-6-(2,2,2-trifluoroethyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide (PubChem CID 67304855) has the molecular formula C26H31F3N2O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxy-1-phenyl-4-[[(4S)-6-(2,2,2-trifluoroethyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-3-hydroxy-1-phenyl-4-[[(4S)-6-(2,2,2-trifluoroethyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 67304855 |
| Molecular Formula | C26H31F3N2O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[(2S,3S)-3-hydroxy-1-phenyl-4-[[(4S)-6-(2,2,2-trifluoroethyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN[C@H]1CC2(CCC2)Oc2ccc(CC(F)(F)F)cc21 |
| InChI | InChI=1S/C26H31F3N2O3/c1-17(32)31-21(13-18-6-3-2-4-7-18)23(33)16-30-22-15-25(10-5-11-25)34-24-9-8-19(12-20(22)24)14-26(27,28)29/h2-4,6-9,12,21-23,30,33H,5,10-11,13-16H2,1H3,(H,31,32)/t21-,22-,23-/m0/s1 |
| InChIKey | FBROWPFAYHWNAP-VABKMULXSA-N |
| XLogP | 4.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |