C28H33N3O4 — CID 90254860
N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 90254860) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90254860 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[(2S,3S)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1ccno1)CC1(CCC1)O2 |
| InChI | InChI=1S/C28H33N3O4/c1-2-19-9-10-25-21(15-19)23(17-28(34-25)12-6-13-28)29-18-24(32)22(16-20-7-4-3-5-8-20)31-27(33)26-11-14-30-35-26/h3-5,7-11,14-15,22-24,29,32H,2,6,12-13,16-18H2,1H3,(H,31,33)/t22-,23-,24-/m0/s1 |
| InChIKey | ASWJHXYZDGRNAX-HJOGWXRNSA-N |
| XLogP | 3.98 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |