C33H46N2O4 — CID 154331057
2-(cyclopropylmethoxy)-N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]acetamide (PubChem CID 154331057) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(cyclopropylmethoxy)-N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 154331057 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 2-(cyclopropylmethoxy)-N-[(2S,3R)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(C)(C)Cc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)COCC1CC1)CC1(CCC1)O2 |
| InChI | InChI=1S/C33H46N2O4/c1-32(2,3)18-25-12-13-30-26(16-25)28(19-33(39-30)14-7-15-33)34-20-29(36)27(17-23-8-5-4-6-9-23)35-31(37)22-38-21-24-10-11-24/h4-6,8-9,12-13,16,24,27-29,34,36H,7,10-11,14-15,17-22H2,1-3H3,(H,35,37)/t27-,28-,29+/m0/s1 |
| InChIKey | BNRKCCPLGOJHEY-YTCPBCGMSA-N |
| XLogP | 5.13 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |