C28H38FN3O3 — CID 68696551
N-[(2S,3S)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-c]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 68696551) has the molecular formula C28H38FN3O3 and a molecular weight of 483.63 g/mol. Its IUPAC name is N-[(2S,3S)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-c]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-c]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68696551 |
| Molecular Formula | C28H38FN3O3 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-[(2S,3S)-4-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-c]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(3-fluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cccc(F)c1)[C@@H](O)CN[C@H]1CC2(CCC2)Oc2cnc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C28H38FN3O3/c1-18(33)32-23(12-19-7-5-8-20(29)11-19)25(34)16-31-24-15-28(9-6-10-28)35-26-17-30-21(13-22(24)26)14-27(2,3)4/h5,7-8,11,13,17,23-25,31,34H,6,9-10,12,14-16H2,1-4H3,(H,32,33)/t23-,24-,25-/m0/s1 |
| InChIKey | JPBCQIQRKPOMKT-SDHOMARFSA-N |
| XLogP | 4.25 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |