C31H34F2N2O5S — CID 142904408
acetylene;phenyl N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxy-3-methylbutan-2-yl]carbamate (PubChem CID 142904408) has the molecular formula C31H34F2N2O5S and a molecular weight of 584.69 g/mol. Its IUPAC name is acetylene;phenyl N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxy-3-methylbutan-2-yl]carbamate.
| Compound Name | acetylene;phenyl N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxy-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142904408 |
| Molecular Formula | C31H34F2N2O5S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | acetylene;phenyl N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxy-3-methylbutan-2-yl]carbamate |
| SMILES | C#C.CCc1ccc2c(c1)[C@@H](NC[C@@](C)(O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)Oc1ccccc1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C29H32F2N2O5S.C2H2/c1-3-19-9-10-21-16-39(36,37)17-26(25(21)13-19)32-18-29(2,35)27(14-20-11-22(30)15-23(31)12-20)33-28(34)38-24-7-5-4-6-8-24;1-2/h4-13,15,26-27,32,35H,3,14,16-18H2,1-2H3,(H,33,34);1-2H/t26-,27-,29+;/m0./s1 |
| InChIKey | CBVROMJLZZTVLU-LKJZLNBCSA-N |
| XLogP | 4.49 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|