C28H33F2N3O4S — CID 69296454
1-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dihydroxy-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]-1-phenylurea (PubChem CID 69296454) has the molecular formula C28H33F2N3O4S and a molecular weight of 545.65 g/mol. Its IUPAC name is 1-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dihydroxy-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]-1-phenylurea.
| Compound Name | 1-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dihydroxy-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]-1-phenylurea |
|---|---|
| PubChem CID | 69296454 |
| Molecular Formula | C28H33F2N3O4S |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 1-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(4R)-6-ethyl-2,2-dihydroxy-3,4-dihydro-1H-isothiochromen-4-yl]amino]-3-hydroxybutan-2-yl]-1-phenylurea |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@H](O)[C@H](Cc1cc(F)cc(F)c1)N(C(N)=O)c1ccccc1)CS(O)(O)C2 |
| InChI | InChI=1S/C28H33F2N3O4S/c1-2-18-8-9-20-16-38(36,37)17-25(24(20)12-18)32-15-27(34)26(13-19-10-21(29)14-22(30)11-19)33(28(31)35)23-6-4-3-5-7-23/h3-12,14,25-27,32,34,36-37H,2,13,15-17H2,1H3,(H2,31,35)/t25-,26-,27-/m0/s1 |
| InChIKey | KSRBPXQMIPHWNR-QKDODKLFSA-N |
| XLogP | 4.98 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |