C21H27F2N2O3S+ — CID 142904403
(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[(4R)-6-ethyl-2-hydroxy-2-oxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]butan-2-ol (PubChem CID 142904403) has the molecular formula C21H27F2N2O3S+ and a molecular weight of 425.52 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[(4R)-6-ethyl-2-hydroxy-2-oxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[(4R)-6-ethyl-2-hydroxy-2-oxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 142904403 |
| Molecular Formula | C21H27F2N2O3S+ |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[(4R)-6-ethyl-2-hydroxy-2-oxo-3,4-dihydro-1H-isothiochromen-4-yl]amino]butan-2-ol |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@@H](N)Cc1cc(F)cc(F)c1)C[S+](=O)(O)C2 |
| InChI | InChI=1S/C21H26F2N2O3S/c1-2-13-3-4-15-11-29(27,28)12-20(18(15)7-13)25-10-21(26)19(24)8-14-5-16(22)9-17(23)6-14/h3-7,9,19-21,25-26H,2,8,10-12,24H2,1H3/p+1/t19-,20-,21+/m0/s1 |
| InChIKey | BJJQBKNOTGEZNH-PCCBWWKXSA-O |
| XLogP | 2.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|