C24H29ClF4N2O2 — CID 68539118
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2,2-difluoroacetamide;hydrochloride (PubChem CID 68539118) has the molecular formula C24H29ClF4N2O2 and a molecular weight of 488.95 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2,2-difluoroacetamide;hydrochloride.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2,2-difluoroacetamide;hydrochloride |
|---|---|
| PubChem CID | 68539118 |
| Molecular Formula | C24H29ClF4N2O2 |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2,2-difluoroacetamide;hydrochloride |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)C(F)F)CCC2.Cl |
| InChI | InChI=1S/C24H28F4N2O2.ClH/c1-2-14-6-7-16-4-3-5-20(19(16)10-14)29-13-22(31)21(30-24(32)23(27)28)11-15-8-17(25)12-18(26)9-15;/h6-10,12,20-23,29,31H,2-5,11,13H2,1H3,(H,30,32);1H/t20-,21-,22-;/m0./s1 |
| InChIKey | UBFYGPXRTWUUEB-SGIIKHNDSA-N |
| XLogP | 4.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |