C24H30F2N2OS — CID 87488010
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]ethanethioamide (PubChem CID 87488010) has the molecular formula C24H30F2N2OS and a molecular weight of 432.58 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]ethanethioamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 87488010 |
| Molecular Formula | C24H30F2N2OS |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]ethanethioamide |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=S)CCC2 |
| InChI | InChI=1S/C24H30F2N2OS/c1-3-16-7-8-18-5-4-6-22(21(18)11-16)27-14-24(29)23(28-15(2)30)12-17-9-19(25)13-20(26)10-17/h7-11,13,22-24,27,29H,3-6,12,14H2,1-2H3,(H,28,30)/t22-,23-,24-/m0/s1 |
| InChIKey | ZGPLJKRQATXADC-HJOGWXRNSA-N |
| XLogP | 4.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|