C27H30F2N4O2 — CID 69298752
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pyrazine-2-carboxamide (PubChem CID 69298752) has the molecular formula C27H30F2N4O2 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 69298752 |
| Molecular Formula | C27H30F2N4O2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pyrazine-2-carboxamide |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1cnccn1)CCC2 |
| InChI | InChI=1S/C27H30F2N4O2/c1-2-17-6-7-19-4-3-5-23(22(19)12-17)32-16-26(34)24(13-18-10-20(28)14-21(29)11-18)33-27(35)25-15-30-8-9-31-25/h6-12,14-15,23-24,26,32,34H,2-5,13,16H2,1H3,(H,33,35)/t23-,24-,26-/m0/s1 |
| InChIKey | HJTSFUXKJNQXLA-GNKBHMEESA-N |
| XLogP | 3.69 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |