C28H31F2N3O3 — CID 58866075
N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 58866075) has the molecular formula C28H31F2N3O3 and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58866075 |
| Molecular Formula | C28H31F2N3O3 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[[(1R)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | CCc1ccc2c(c1)[C@H](NC[C@H](O)[C@@H](Cc1cc(F)cc(F)c1)NC(=O)c1cccc(=O)[nH]1)CCC2 |
| InChI | InChI=1S/C28H31F2N3O3/c1-2-17-9-10-19-5-3-6-23(22(19)13-17)31-16-26(34)25(14-18-11-20(29)15-21(30)12-18)33-28(36)24-7-4-8-27(35)32-24/h4,7-13,15,23,25-26,31,34H,2-3,5-6,14,16H2,1H3,(H,32,35)(H,33,36)/t23-,25-,26+/m1/s1 |
| InChIKey | IBWKWRLARFQBQZ-ARMFNRFLSA-N |
| XLogP | 3.58 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |