C32H35F2N3O2 — CID 163420100
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2-(1H-indol-3-yl)acetamide (PubChem CID 163420100) has the molecular formula C32H35F2N3O2 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 163420100 |
| Molecular Formula | C32H35F2N3O2 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]-2-(1H-indol-3-yl)acetamide |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)Cc1c[nH]c3ccccc13)CCC2 |
| InChI | InChI=1S/C32H35F2N3O2/c1-2-20-10-11-22-6-5-9-29(27(22)14-20)36-19-31(38)30(15-21-12-24(33)17-25(34)13-21)37-32(39)16-23-18-35-28-8-4-3-7-26(23)28/h3-4,7-8,10-14,17-18,29-31,35-36,38H,2,5-6,9,15-16,19H2,1H3,(H,37,39)/t29-,30-,31+/m0/s1 |
| InChIKey | AHSRNODMTBIUAS-RWSKJCERSA-N |
| XLogP | 5.31 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |