C25H30F2N2O2 — CID 68668407
N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide (PubChem CID 68668407) has the molecular formula C25H30F2N2O2 and a molecular weight of 428.52 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68668407 |
| Molecular Formula | C25H30F2N2O2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
| SMILES | C=C(C)c1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O)CCC2 |
| InChI | InChI=1S/C25H30F2N2O2/c1-15(2)19-8-7-18-5-4-6-23(22(18)12-19)28-14-25(31)24(29-16(3)30)11-17-9-20(26)13-21(27)10-17/h7-10,12-13,23-25,28,31H,1,4-6,11,14H2,2-3H3,(H,29,30)/t23-,24-,25+/m0/s1 |
| InChIKey | FVTUZGPHLWZYNU-CCDWMCETSA-N |
| XLogP | 4.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |