C27H30F2N2O2S — CID 68667783
N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[7-(5-methylthiophen-2-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide (PubChem CID 68667783) has the molecular formula C27H30F2N2O2S and a molecular weight of 484.61 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[7-(5-methylthiophen-2-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[7-(5-methylthiophen-2-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68667783 |
| Molecular Formula | C27H30F2N2O2S |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[7-(5-methylthiophen-2-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)CNC1CCCc2ccc(-c3ccc(C)s3)cc21 |
| InChI | InChI=1S/C27H30F2N2O2S/c1-16-6-9-27(34-16)20-8-7-19-4-3-5-24(23(19)13-20)30-15-26(33)25(31-17(2)32)12-18-10-21(28)14-22(29)11-18/h6-11,13-14,24-26,30,33H,3-5,12,15H2,1-2H3,(H,31,32)/t24?,25-,26-/m0/s1 |
| InChIKey | JGQFJJFOBBRYJZ-WIXBZOCESA-N |
| XLogP | 5.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |