C29H32F2N2O3 — CID 10074470
phenyl N-[(3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]carbamate (PubChem CID 10074470) has the molecular formula C29H32F2N2O3 and a molecular weight of 494.58 g/mol. Its IUPAC name is phenyl N-[(3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]carbamate.
| Compound Name | phenyl N-[(3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10074470 |
| Molecular Formula | C29H32F2N2O3 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | phenyl N-[(3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]carbamate |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)C(Cc1cc(F)cc(F)c1)NC(=O)Oc1ccccc1)CCC2 |
| InChI | InChI=1S/C29H32F2N2O3/c1-2-19-11-12-21-7-6-10-26(25(21)15-19)32-18-28(34)27(16-20-13-22(30)17-23(31)14-20)33-29(35)36-24-8-4-3-5-9-24/h3-5,8-9,11-15,17,26-28,32,34H,2,6-7,10,16,18H2,1H3,(H,33,35)/t26-,27?,28+/m0/s1 |
| InChIKey | ZZXRFSDVACDVLU-RSTHSURTSA-N |
| XLogP | 5.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |