C25H34F2N2O — CID 59365392
(2R)-3-amino-4-(3,5-difluorophenyl)-1-[[7-(2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-ol (PubChem CID 59365392) has the molecular formula C25H34F2N2O and a molecular weight of 416.56 g/mol. Its IUPAC name is (2R)-3-amino-4-(3,5-difluorophenyl)-1-[[7-(2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-ol.
| Compound Name | (2R)-3-amino-4-(3,5-difluorophenyl)-1-[[7-(2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 59365392 |
| Molecular Formula | C25H34F2N2O |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (2R)-3-amino-4-(3,5-difluorophenyl)-1-[[7-(2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-ol |
| SMILES | CC(C)(C)Cc1ccc2c(c1)C(NC[C@@H](O)C(N)Cc1cc(F)cc(F)c1)CCC2 |
| InChI | InChI=1S/C25H34F2N2O/c1-25(2,3)14-16-7-8-18-5-4-6-23(21(18)11-16)29-15-24(30)22(28)12-17-9-19(26)13-20(27)10-17/h7-11,13,22-24,29-30H,4-6,12,14-15,28H2,1-3H3/t22?,23?,24-/m1/s1 |
| InChIKey | OEEYUZPPARUOSD-KXTRFFEISA-N |
| XLogP | 4.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |