C26H35F2N3O — CID 68979086
N-[(2S,3S)-3-amino-1-(3,5-difluorophenyl)-4-[[(1S)-7-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide (PubChem CID 68979086) has the molecular formula C26H35F2N3O and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[(2S,3S)-3-amino-1-(3,5-difluorophenyl)-4-[[(1S)-7-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-3-amino-1-(3,5-difluorophenyl)-4-[[(1S)-7-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68979086 |
| Molecular Formula | C26H35F2N3O |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | N-[(2S,3S)-3-amino-1-(3,5-difluorophenyl)-4-[[(1S)-7-(2-methylpropyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](N)CN[C@H]1CCCc2ccc(CC(C)C)cc21 |
| InChI | InChI=1S/C26H35F2N3O/c1-16(2)9-18-7-8-20-5-4-6-25(23(20)12-18)30-15-24(29)26(31-17(3)32)13-19-10-21(27)14-22(28)11-19/h7-8,10-12,14,16,24-26,30H,4-6,9,13,15,29H2,1-3H3,(H,31,32)/t24-,25-,26-/m0/s1 |
| InChIKey | LVEQABWNBJIIBL-GSDHBNRESA-N |
| XLogP | 4.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |