C33H40F2N4O5S — CID 21086982
1-N-[1-(3,5-difluorophenyl)-4-[(2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 21086982) has the molecular formula C33H40F2N4O5S and a molecular weight of 642.77 g/mol. Its IUPAC name is 1-N-[1-(3,5-difluorophenyl)-4-[(2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[1-(3,5-difluorophenyl)-4-[(2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 21086982 |
| Molecular Formula | C33H40F2N4O5S |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 1-N-[1-(3,5-difluorophenyl)-4-[(2,2-dioxo-3,4-dihydro-1H-2λ6,1-benzothiazin-4-yl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CNC2CS(=O)(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C33H40F2N4O5S/c1-4-10-39(11-5-2)33(42)24-13-21(3)12-23(17-24)32(41)37-29(16-22-14-25(34)18-26(35)15-22)31(40)19-36-30-20-45(43,44)38-28-9-7-6-8-27(28)30/h6-9,12-15,17-18,29-31,36,38,40H,4-5,10-11,16,19-20H2,1-3H3,(H,37,41) |
| InChIKey | LFIRBBNVMQIWHH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |