C32H45F2N3O3 — CID 69421003
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(4-methylcyclohexyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 69421003) has the molecular formula C32H45F2N3O3 and a molecular weight of 557.73 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(4-methylcyclohexyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(4-methylcyclohexyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69421003 |
| Molecular Formula | C32H45F2N3O3 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(4-methylcyclohexyl)amino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNC2CCC(C)CC2)c1 |
| InChI | InChI=1S/C32H45F2N3O3/c1-5-11-37(12-6-2)32(40)25-14-22(4)13-24(18-25)31(39)36-29(17-23-15-26(33)19-27(34)16-23)30(38)20-35-28-9-7-21(3)8-10-28/h13-16,18-19,21,28-30,35,38H,5-12,17,20H2,1-4H3,(H,36,39)/t21?,28?,29-,30+/m0/s1 |
| InChIKey | HIMLYGFWFJTRGF-MNONBZLLSA-N |
| XLogP | 5.41 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |