C28H35F2N2O4Y- — CID 58715335
1-N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-6-oxoheptan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;yttrium (PubChem CID 58715335) has the molecular formula C28H35F2N2O4Y- and a molecular weight of 590.50 g/mol. Its IUPAC name is 1-N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-6-oxoheptan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;yttrium.
| Compound Name | 1-N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-6-oxoheptan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;yttrium |
|---|---|
| PubChem CID | 58715335 |
| Molecular Formula | C28H35F2N2O4Y- |
| Molecular Weight | 590.50 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | 1-N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-6-oxoheptan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;yttrium |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)C[CH-]C(C)=O)c1.[Y] |
| InChI | InChI=1S/C28H35F2N2O4.Y/c1-5-9-32(10-6-2)28(36)22-12-18(3)11-21(16-22)27(35)31-25(26(34)8-7-19(4)33)15-20-13-23(29)17-24(30)14-20;/h7,11-14,16-17,25-26,34H,5-6,8-10,15H2,1-4H3,(H,31,35);/q-1;/t25-,26-;/m0./s1 |
| InChIKey | YRCSRCZEYTZARZ-CCQIZPNASA-N |
| XLogP | 4.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|