C29H40F2N2O4 — CID 59067284
1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxyoctan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 59067284) has the molecular formula C29H40F2N2O4 and a molecular weight of 518.65 g/mol. Its IUPAC name is 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxyoctan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxyoctan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59067284 |
| Molecular Formula | C29H40F2N2O4 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxyoctan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCC[C@@H](O)[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C29H40F2N2O4/c1-5-8-9-26(34)27(35)25(16-20-14-23(30)18-24(31)15-20)32-28(36)21-12-19(4)13-22(17-21)29(37)33(10-6-2)11-7-3/h12-15,17-18,25-27,34-35H,5-11,16H2,1-4H3,(H,32,36)/t25-,26+,27+/m0/s1 |
| InChIKey | RWJSXDABPVWKTG-OYUWMTPXSA-N |
| XLogP | 4.79 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |