C28H34F2N4O5 — CID 10302544
1-N-[6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 10302544) has the molecular formula C28H34F2N4O5 and a molecular weight of 544.60 g/mol. Its IUPAC name is 1-N-[6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 10302544 |
| Molecular Formula | C28H34F2N4O5 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 1-N-[6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)C(O)CCC#N)c1 |
| InChI | InChI=1S/C28H34F2N4O5/c1-3-8-34(9-4-2)28(39)20-14-18(26(32)37)13-19(15-20)27(38)33-23(25(36)24(35)6-5-7-31)12-17-10-21(29)16-22(30)11-17/h10-11,13-16,23-25,35-36H,3-6,8-9,12H2,1-2H3,(H2,32,37)(H,33,38) |
| InChIKey | KTIYLBABYLJJCK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 156.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |