C32H44F2N4O6 — CID 58635624
1-N-[(2S,3R,4R,5R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 58635624) has the molecular formula C32H44F2N4O6 and a molecular weight of 618.72 g/mol. Its IUPAC name is 1-N-[(2S,3R,4R,5R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R,4R,5R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 58635624 |
| Molecular Formula | C32H44F2N4O6 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 1-N-[(2S,3R,4R,5R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-(2-methylpropylamino)-6-oxohexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)[C@H](O)[C@@H](C)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C32H44F2N4O6/c1-6-8-38(9-7-2)32(44)23-14-21(29(35)41)13-22(15-23)31(43)37-26(12-20-10-24(33)16-25(34)11-20)28(40)27(39)19(5)30(42)36-17-18(3)4/h10-11,13-16,18-19,26-28,39-40H,6-9,12,17H2,1-5H3,(H2,35,41)(H,36,42)(H,37,43)/t19-,26+,27-,28-/m1/s1 |
| InChIKey | UGOGTEAYBBGJJC-WIWHYGFKSA-N |
| XLogP | 2.80 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |