C34H40F2N4O6 — CID 22051306
1-N-[5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 22051306) has the molecular formula C34H40F2N4O6 and a molecular weight of 638.71 g/mol. Its IUPAC name is 1-N-[5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 22051306 |
| Molecular Formula | C34H40F2N4O6 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | 1-N-[5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)C(O)C(C)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H40F2N4O6/c1-4-11-40(12-5-2)34(46)25-17-23(31(37)43)16-24(18-25)33(45)39-28(15-21-13-26(35)19-27(36)14-21)30(42)29(41)20(3)38-32(44)22-9-7-6-8-10-22/h6-10,13-14,16-20,28-30,41-42H,4-5,11-12,15H2,1-3H3,(H2,37,43)(H,38,44)(H,39,45) |
| InChIKey | HTVWVJCBQHMJBR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |